EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H26FNO4 |
| Net Charge | 0 |
| Average Mass | 411.473 |
| Monoisotopic Mass | 411.18459 |
| SMILES | CC(C)n1c(/C=C/[C@H](O)C[C@H](O)CC(=O)O)c(-c2ccc(F)cc2)c2ccccc21 |
| InChI | InChI=1S/C24H26FNO4/c1-15(2)26-21-6-4-3-5-20(21)24(16-7-9-17(25)10-8-16)22(26)12-11-18(27)13-19(28)14-23(29)30/h3-12,15,18-19,27-28H,13-14H2,1-2H3,(H,29,30)/b12-11+/t18-,19-/m0/s1 |
| InChIKey | FJLGEFLZQAZZCD-JUFISIKESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 1.1.1.34/EC 1.1.1.88 (hydroxymethylglutaryl-CoA reductase) inhibitor Any EC 1.1.1.* (oxidoreductase acting on donor CH-OH group, NAD+ or NADP+ acceptor) inhibitor that inhibits HMG-CoA reductases. Hydroxymethylglutaryl-CoA reductase inhibitors have been shown to lower directly cholesterol synthesis. The Enzyme Commission designation is EC 1.1.1.34 for the NADPH-dependent enzyme and EC 1.1.1.88 for an NADH-dependent enzyme. |
| Application: | anticholesteremic drug A substance used to lower plasma cholesterol levels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3S,5R)-fluvastatin (CHEBI:5136) is a (6E)-7-[3-(4-fluorophenyl)-1-(propan-2-yl)-1H-indol-2-yl]-3,5-dihydroxyhept-6-enoic acid (CHEBI:38562) |
| (3S,5R)-fluvastatin (CHEBI:5136) is a statin (synthetic) (CHEBI:87635) |
| (3S,5R)-fluvastatin (CHEBI:5136) is conjugate acid of (3S,5R)-fluvastatin(1−) (CHEBI:77601) |
| (3S,5R)-fluvastatin (CHEBI:5136) is enantiomer of (3R,5S)-fluvastatin (CHEBI:38565) |
| Incoming Relation(s) |
| fluvastatin (CHEBI:38561) has part (3S,5R)-fluvastatin (CHEBI:5136) |
| (3S,5R)-fluvastatin(1−) (CHEBI:77601) is conjugate base of (3S,5R)-fluvastatin (CHEBI:5136) |
| (3R,5S)-fluvastatin (CHEBI:38565) is enantiomer of (3S,5R)-fluvastatin (CHEBI:5136) |
| IUPAC Name |
|---|
| (3S,5R,6E)-7-[3-(4-fluorophenyl)-1-(propan-2-yl)-1H-indol-2-yl]-3,5-dihydroxyhept-6-enoic acid |
| Synonyms | Source |
|---|---|
| (3S,5R,6E)-7-[3-(4-fluorophenyl)-1-isopropyl-1H-indol-2-yl]-3,5-dihydroxyhept-6-enoic acid | IUPAC |
| (−)-(3S,5R)-fluvastatin | ChEBI |
| (3S,5R)-(−)-fluvastatin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| D07983 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8169391 | Reaxys |
| Citations |
|---|