EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H26FNO4 |
| Net Charge | 0 |
| Average Mass | 411.473 |
| Monoisotopic Mass | 411.18459 |
| SMILES | CC(C)n1c(/C=C/[C@H](O)C[C@H](O)CC(=O)O)c(-c2ccc(F)cc2)c2ccccc21 |
| InChI | InChI=1S/C24H26FNO4/c1-15(2)26-21-6-4-3-5-20(21)24(16-7-9-17(25)10-8-16)22(26)12-11-18(27)13-19(28)14-23(29)30/h3-12,15,18-19,27-28H,13-14H2,1-2H3,(H,29,30)/b12-11+/t18-,19-/m0/s1 |
| InChIKey | FJLGEFLZQAZZCD-JUFISIKESA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 3.4.24.83 (anthrax lethal factor endopeptidase) inhibitor An EC 3.4.24.* (metalloendopeptidase) inhibitor that interferes with the action of anthrax lethal factor endopeptidase (EC 3.4.24.83). EC 1.1.1.34/EC 1.1.1.88 (hydroxymethylglutaryl-CoA reductase) inhibitor Any EC 1.1.1.* (oxidoreductase acting on donor CH-OH group, NAD+ or NADP+ acceptor) inhibitor that inhibits HMG-CoA reductases. Hydroxymethylglutaryl-CoA reductase inhibitors have been shown to lower directly cholesterol synthesis. The Enzyme Commission designation is EC 1.1.1.34 for the NADPH-dependent enzyme and EC 1.1.1.88 for an NADH-dependent enzyme. |
| Applications: | anticholesteremic drug A substance used to lower plasma cholesterol levels. anticholesteremic drug A substance used to lower plasma cholesterol levels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fluvastatin (CHEBI:38561) has part (3R,5S)-fluvastatin (CHEBI:38565) |
| fluvastatin (CHEBI:38561) has part (3S,5R)-fluvastatin (CHEBI:5136) |
| fluvastatin (CHEBI:38561) has role anticholesteremic drug (CHEBI:35821) |
| fluvastatin (CHEBI:38561) has role EC 3.4.24.83 (anthrax lethal factor endopeptidase) inhibitor (CHEBI:77255) |
| fluvastatin (CHEBI:38561) is a racemate (CHEBI:60911) |
| fluvastatin (CHEBI:38561) is a statin (synthetic) (CHEBI:87635) |
| IUPAC Name |
|---|
| rac-(3R,5S,6E)-7-[3-(4-fluorophenyl)-1-(propan-2-yl)-1H-indol-2-yl]-3,5-dihydroxyhept-6-enoic acid |
| INNs | Source |
|---|---|
| fluvastatin | WHO MedNet |
| fluvastatina | WHO MedNet |
| fluvastatine | WHO MedNet |
| fluvastatinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| (6E)-erythro7-[3-(4-fluorophenyl)-1-(propan-2-yl)-1H-indol-2-yl]-3,5-dihydroxyhept-6-enoic acid | ChEBI |
| rac-(3R,5S,6E)-7-(3-(4-fluorophenyl)-1-(1-methylethyl)-1H-indol-2-yl)-3,5-dihydroxy-6-heptenoic acid | ChEBI |
| rac-(3R,5S)-fluvastatin | ChEBI |
| (±)-fluvastatin | ChEBI |
| erythro-(E)-3,5-dihydroxy-7-[3'-(4''-fluorophenyl)-1'-(1''-methylethyl)indol-2'-yl]hept-6-enoic acid | ChEBI |
| Brand Name | Source |
|---|---|
| Cranoc | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:9168031 | Beilstein |
| CAS:93957-54-1 | ChemIDplus |
| CAS:93957-54-1 | KEGG COMPOUND |
| Citations |
|---|