EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H17N2O4S.Na |
| Net Charge | 0 |
| Average Mass | 356.379 |
| Monoisotopic Mass | 356.08067 |
| SMILES | [H][C@]12SC(C)(C)[C@H](C(=O)[O-])N1C(=O)[C@H]2NC(=O)Cc1ccccc1.[Na+] |
| InChI | InChI=1S/C16H18N2O4S.Na/c1-16(2)12(15(21)22)18-13(20)11(14(18)23-16)17-10(19)8-9-6-4-3-5-7-9;/h3-7,11-12,14H,8H2,1-2H3,(H,17,19)(H,21,22);/q;+1/p-1/t11-,12+,14-;/m1./s1 |
| InChIKey | FCPVYOBCFFNJFS-LQDWTQKMSA-M |
| Roles Classification |
|---|
| Application: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzylpenicillin sodium (CHEBI:51765) has part benzylpenicillin(1−) (CHEBI:51354) |
| benzylpenicillin sodium (CHEBI:51765) has role antiinfective agent (CHEBI:35441) |
| benzylpenicillin sodium (CHEBI:51765) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium 2,2-dimethyl-6β-(phenylacetamido)penam-3α-carboxylate |
| Synonyms | Source |
|---|---|
| American penicillin | ChemIDplus |
| benzylpenicillinic acid sodium salt | ChemIDplus |
| Benzyl penicillin sodium | ChEMBL |
| benzylpenicillin sodium salt | ChemIDplus |
| Benzylpenicillinum natricum | ChEMBL |
| E706 | ChEMBL |
| Brand Name | Source |
|---|---|
| Crystapen | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3834217 | Beilstein |
| CAS:69-57-8 | ChemIDplus |
| Citations |
|---|