EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:7963 - benzylpenicillin potassium
| Formula | C16H17N2O4S.K |
| Net Charge | 0 |
| Average Mass | 372.487 |
| Monoisotopic Mass | 372.05461 |
| SMILES | [H][C@]12SC(C)(C)[C@H](C(=O)[O-])N1C(=O)[C@H]2NC(=O)Cc1ccccc1.[K+] |
| InChI | InChI=1S/C16H18N2O4S.K/c1-16(2)12(15(21)22)18-13(20)11(14(18)23-16)17-10(19)8-9-6-4-3-5-7-9;/h3-7,11-12,14H,8H2,1-2H3,(H,17,19)(H,21,22);/q;+1/p-1/t11-,12+,14-;/m1./s1 |
| InChIKey | IYNDLOXRXUOGIU-LQDWTQKMSA-M |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzylpenicillin potassium (CHEBI:7963) has part benzylpenicillin(1−) (CHEBI:51354) |
| benzylpenicillin potassium (CHEBI:7963) has role antiinfective agent (CHEBI:35441) |
| benzylpenicillin potassium (CHEBI:7963) has role antimicrobial agent (CHEBI:33281) |
| benzylpenicillin potassium (CHEBI:7963) has role antineoplastic agent (CHEBI:35610) |
| benzylpenicillin potassium (CHEBI:7963) is a organic potassium salt (CHEBI:50394) |
| IUPAC Name |
|---|
| potassium 2,2-dimethyl-6β-(phenylacetamido)penam-3α-carboxylate |
| Synonyms | Source |
|---|---|
| 6β-phenylacetamidopenicillanic acid potassium salt | ChEBI |
| benzylpénicilline potassique | ChemIDplus |
| benzylpenicillin potassium salt | ChemIDplus |
| E705 | ChEMBL |
| NSC-131815 | ChEMBL |
| penicillin G K | ChemIDplus |
| Brand Names | Source |
|---|---|
| Cilloral | ChEMBL |
| Penicillin-2 | ChEMBL |
| Pentids | ChEMBL |
| Pentids '200' | ChEMBL |
| Pentids '250' | ChEMBL |
| Pentids '400' | ChEMBL |
| Citations |
|---|