EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H15N3 |
| Net Charge | 0 |
| Average Mass | 249.317 |
| Monoisotopic Mass | 249.12660 |
| SMILES | NC1=NCC2c3ccccc3Cc3ccccc3N12 |
| InChI | InChI=1S/C16H15N3/c17-16-18-10-15-13-7-3-1-5-11(13)9-12-6-2-4-8-14(12)19(15)16/h1-8,15H,9-10H2,(H2,17,18) |
| InChIKey | WHWZLSFABNNENI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. |
| Applications: | anti-allergic agent A drug used to treat allergic reactions. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| epinastine (CHEBI:51032) has role anti-allergic agent (CHEBI:50857) |
| epinastine (CHEBI:51032) has role H1-receptor antagonist (CHEBI:37955) |
| epinastine (CHEBI:51032) has role histamine antagonist (CHEBI:37956) |
| epinastine (CHEBI:51032) has role ophthalmology drug (CHEBI:66981) |
| epinastine (CHEBI:51032) is a benzazepine (CHEBI:35676) |
| epinastine (CHEBI:51032) is a guanidines (CHEBI:24436) |
| Incoming Relation(s) |
| epinastine hydrochloride (CHEBI:51037) has part epinastine (CHEBI:51032) |
| R-epinastine (CHEBI:51035) is a epinastine (CHEBI:51032) |
| S-epinastine (CHEBI:51036) is a epinastine (CHEBI:51032) |
| IUPAC Name |
|---|
| 9,13b-dihydro-1H-dibenzo[c,f]imidazo[1,5-a]azepin-3-amine |
| INNs | Source |
|---|---|
| epinastine | ChemIDplus |
| epinastina | ChemIDplus |
| épinastine | ChemIDplus |
| epinastinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 3-amino-9,13b-dihydro-1H-dibenz(c,f)imidazo(1,5-a)azepine | ChemIDplus |
| (±)-epinastine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3593307 | Reaxys |
| CAS:80012-43-7 | ChemIDplus |