EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:51035 - R-epinastine
| Formula | C16H15N3 |
| Net Charge | 0 |
| Average Mass | 249.317 |
| Monoisotopic Mass | 249.12660 |
| SMILES | [H][C@@]12CN=C(N)N1c1ccccc1Cc1ccccc12 |
| InChI | InChI=1S/C16H15N3/c17-16-18-10-15-13-7-3-1-5-11(13)9-12-6-2-4-8-14(12)19(15)16/h1-8,15H,9-10H2,(H2,17,18)/t15-/m0/s1 |
| InChIKey | WHWZLSFABNNENI-HNNXBMFYSA-N |
| Roles Classification |
|---|
| Biological Roles: | histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| Applications: | histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. anti-allergic agent A drug used to treat allergic reactions. ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| R-epinastine (CHEBI:51035) is a epinastine (CHEBI:51032) |
| R-epinastine (CHEBI:51035) is enantiomer of S-epinastine (CHEBI:51036) |
| Incoming Relation(s) |
| S-epinastine (CHEBI:51036) is enantiomer of R-epinastine (CHEBI:51035) |
| IUPAC Name |
|---|
| 9,(13bR)-dihydro-1H-dibenzo[c,f]imidazo[1,5-a]azepin-3-amine |
| Manual Xrefs | Databases |
|---|---|
| DB00751 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4354563 | Beilstein |