EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:51036 - S-epinastine
| Formula | C16H15N3 |
| Net Charge | 0 |
| Average Mass | 249.317 |
| Monoisotopic Mass | 249.12660 |
| SMILES | [H][C@]12CN=C(N)N1c1ccccc1Cc1ccccc12 |
| InChI | InChI=1S/C16H15N3/c17-16-18-10-15-13-7-3-1-5-11(13)9-12-6-2-4-8-14(12)19(15)16/h1-8,15H,9-10H2,(H2,17,18)/t15-/m1/s1 |
| InChIKey | WHWZLSFABNNENI-OAHLLOKOSA-N |
| Roles Classification |
|---|
| Biological Roles: | histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| Applications: | ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. anti-allergic agent A drug used to treat allergic reactions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-epinastine (CHEBI:51036) is a epinastine (CHEBI:51032) |
| S-epinastine (CHEBI:51036) is enantiomer of R-epinastine (CHEBI:51035) |
| Incoming Relation(s) |
| R-epinastine (CHEBI:51035) is enantiomer of S-epinastine (CHEBI:51036) |
| IUPAC Name |
|---|
| 9,(13bS)-dihydro-1H-dibenzo[c,f]imidazo[1,5-a]azepin-3-amine |
| Manual Xrefs | Databases |
|---|---|
| DB00751 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4354564 | Beilstein |