EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H.C16H15N3.Cl |
| Net Charge | 0 |
| Average Mass | 285.778 |
| Monoisotopic Mass | 285.10328 |
| SMILES | NC1=NCC2c3ccccc3Cc3ccccc3N12.[Cl-].[H+] |
| InChI | InChI=1S/C16H15N3.ClH/c17-16-18-10-15-13-7-3-1-5-11(13)9-12-6-2-4-8-14(12)19(15)16;/h1-8,15H,9-10H2,(H2,17,18);1H |
| InChIKey | VKXSGUIOOQPGAF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| epinastine hydrochloride (CHEBI:51037) has part epinastine (CHEBI:51032) |
| epinastine hydrochloride (CHEBI:51037) has role ophthalmology drug (CHEBI:66981) |
| epinastine hydrochloride (CHEBI:51037) is a hydrochloride (CHEBI:36807) |
| Synonyms | Source |
|---|---|
| DE-114 | ChEMBL |
| WAL 801 CL | ChEMBL |
| WAL-801CL | ChEMBL |
| WAL-802-CL | ChEMBL |
| Brand Names | Source |
|---|---|
| Elestat | ChEMBL |
| Relestat | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| DB00751 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3576207 | Beilstein |