EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H17ClFN3O5S |
| Net Charge | 0 |
| Average Mass | 453.879 |
| Monoisotopic Mass | 453.05615 |
| SMILES | [H][C@]12SC(C)(C)[C@H](C(=O)O)N1C(=O)[C@H]2NC(=O)c1c(-c2c(F)cccc2Cl)noc1C |
| InChI | InChI=1S/C19H17ClFN3O5S/c1-7-10(12(23-29-7)11-8(20)5-4-6-9(11)21)15(25)22-13-16(26)24-14(18(27)28)19(2,3)30-17(13)24/h4-6,13-14,17H,1-3H3,(H,22,25)(H,27,28)/t13-,14+,17-/m1/s1 |
| InChIKey | UIOFUWFRIANQPC-JKIFEVAISA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flucloxacillin (CHEBI:5098) has role antibacterial agent (CHEBI:33282) |
| flucloxacillin (CHEBI:5098) has role antibacterial drug (CHEBI:36047) |
| flucloxacillin (CHEBI:5098) has role antiinfective agent (CHEBI:35441) |
| flucloxacillin (CHEBI:5098) is a penicillin (CHEBI:17334) |
| flucloxacillin (CHEBI:5098) is a penicillin allergen (CHEBI:88187) |
| flucloxacillin (CHEBI:5098) is conjugate acid of flucloxacillin(1−) (CHEBI:52037) |
| Incoming Relation(s) |
| flucloxacilloyl-L-lysine (CHEBI:139365) has functional parent flucloxacillin (CHEBI:5098) |
| flucloxacillin(1−) (CHEBI:52037) is conjugate base of flucloxacillin (CHEBI:5098) |
| flucloxacilloyl group (CHEBI:59152) is substituent group from flucloxacillin (CHEBI:5098) |
| flucloxcillanyl group (CHEBI:61616) is substituent group from flucloxacillin (CHEBI:5098) |
| IUPAC Name |
|---|
| 6β-[3-(2-chloro-6-fluorophenyl)-5-methyl-1,2-oxazole-4-carboxamido]-2,2-dimethylpenam-3α-carboxylic acid |
| INNs | Source |
|---|---|
| flucloxacillin | KEGG DRUG |
| flucloxacilline | DrugBank |
| flucloxacillinum | DrugBank |
| Synonyms | Source |
|---|---|
| (2S,5R,6R)-6-({[3-(2-chloro-6-fluorophenyl)-5-methyl-1,2-oxazol-4-yl]carbonyl}amino)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid | IUPAC |
| 3-(2-Chloro-6-fluorophenyl)-5-methyl-4-isoxazolylpenicillin | ChemIDplus |
| BRL 2039 | ChEMBL |
| BRL-2039 | ChEMBL |
| Culpen | ChEMBL |
| floxacillin | ChEMBL |
| Brand Names | Source |
|---|---|
| Abboflox | ChEMBL |
| Floxapen | DrugBank |
| Fluclomix-250 | ChEMBL |
| Fluclomix-500 | ChEMBL |
| Flucloxin | ChEMBL |
| Galfloxin | ChEMBL |
| Citations |
|---|