EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H16ClFN3O4S |
| Net Charge | 0 |
| Average Mass | 436.872 |
| Monoisotopic Mass | 436.05341 |
| SMILES | *C(=O)[C@@H]1N2C(=O)[C@@H](NC(=O)c3c(-c4c(F)cccc4Cl)noc3C)[C@@]2([H])SC1(C)C |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flucloxcillanyl group (CHEBI:61616) has role antibacterial agent (CHEBI:33282) |
| flucloxcillanyl group (CHEBI:61616) is a organyl group (CHEBI:33249) |
| flucloxcillanyl group (CHEBI:61616) is a penicilloyl group allergen (CHEBI:88223) |
| flucloxcillanyl group (CHEBI:61616) is substituent group from flucloxacillin (CHEBI:5098) |
| IUPAC Name |
|---|
| 6β-[3-(2-chloro-6-fluorophenyl)-5-methyl-1,2-oxazole-4-carboxamido]-2,2-dimethylpenam-3α-carbonyl |
| Synonyms | Source |
|---|---|
| 6β-[3-(2-chloro-6-fluorophenyl)-5-methyl-1,2-oxazole-4-carboxamido]-2,2-dimethylpenam-3α-carbonyl group | ChEBI |
| flucloxcillanyl | ChEBI |
| Citations |
|---|