EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H16ClFN3O5S |
| Net Charge | -1 |
| Average Mass | 452.871 |
| Monoisotopic Mass | 452.04887 |
| SMILES | [H][C@]12SC(C)(C)[C@H](C(=O)[O-])N1C(=O)[C@H]2NC(=O)c1c(-c2c(F)cccc2Cl)noc1C |
| InChI | InChI=1S/C19H17ClFN3O5S/c1-7-10(12(23-29-7)11-8(20)5-4-6-9(11)21)15(25)22-13-16(26)24-14(18(27)28)19(2,3)30-17(13)24/h4-6,13-14,17H,1-3H3,(H,22,25)(H,27,28)/p-1/t13-,14+,17-/m1/s1 |
| InChIKey | UIOFUWFRIANQPC-JKIFEVAISA-M |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flucloxacillin(1−) (CHEBI:52037) is a penicillinate anion (CHEBI:51356) |
| flucloxacillin(1−) (CHEBI:52037) is conjugate base of flucloxacillin (CHEBI:5098) |
| Incoming Relation(s) |
| flucloxacillin sodium (CHEBI:31615) has part flucloxacillin(1−) (CHEBI:52037) |
| flucloxacillin (CHEBI:5098) is conjugate acid of flucloxacillin(1−) (CHEBI:52037) |
| IUPAC Name |
|---|
| 6β-[3-(2-chloro-6-fluorophenyl)-5-methyl-1,2-oxazole-4-carboxamido]-2,2-dimethylpenam-3α-carboxylate |
| Synonym | Source |
|---|---|
| (2S,5R,6R)-6-({[3-(2-chloro-6-fluorophenyl)-5-methyl-1,2-oxazol-4-yl]carbonyl}amino)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5397371 | Beilstein |