EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18ClFN3O5S |
| Net Charge | 0 |
| Average Mass | 454.887 |
| Monoisotopic Mass | 454.06397 |
| SMILES | *C(=O)[C@@H](NC(=O)c1c(-c2c(F)cccc2Cl)noc1C)[C@]1([H])N[C@@H](C(=O)O)C(C)(C)S1 |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flucloxacilloyl group (CHEBI:59152) has role antibacterial agent (CHEBI:33282) |
| flucloxacilloyl group (CHEBI:59152) is a organyl group (CHEBI:33249) |
| flucloxacilloyl group (CHEBI:59152) is a penicilloyl group allergen (CHEBI:88223) |
| flucloxacilloyl group (CHEBI:59152) is substituent group from flucloxacillin (CHEBI:5098) |
| Incoming Relation(s) |
| flucloxacilloyl-L-lysine (CHEBI:139365) has part flucloxacilloyl group (CHEBI:59152) |
| IUPAC Name |
|---|
| (1R)-1-[(2R,4S)-4-carboxy-5,5-dimethyl-1,3-thiazolidin-2-yl]-1-({[3-(2-chloro-6-fluorophenyl)-5-methyl-1,2-xazol-4-yl]carbonyl}amino)-2-oxoalkyl |
| Synonym | Source |
|---|---|
| flucloxacilloyl | ChEBI |