EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H10O7 |
| Net Charge | 0 |
| Average Mass | 302.238 |
| Monoisotopic Mass | 302.04265 |
| SMILES | O=c1cc(-c2cc(O)c(O)c(O)c2)oc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C15H10O7/c16-7-3-8(17)14-9(18)5-12(22-13(14)4-7)6-1-10(19)15(21)11(20)2-6/h1-5,16-17,19-21H |
| InChIKey | ARSRJFRKVXALTF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tricetin (CHEBI:507499) has role antineoplastic agent (CHEBI:35610) |
| tricetin (CHEBI:507499) has role metabolite (CHEBI:25212) |
| tricetin (CHEBI:507499) is a pentahydroxyflavone (CHEBI:25883) |
| tricetin (CHEBI:507499) is conjugate acid of tricetin(1-) (CHEBI:60045) |
| Incoming Relation(s) |
| 3'-O-methyltricetin (CHEBI:59976) has functional parent tricetin (CHEBI:507499) |
| 3',4',5'-O-trimethyltricetin (CHEBI:543745) has functional parent tricetin (CHEBI:507499) |
| 3',5'-di-O-methyltricetin (CHEBI:59979) has functional parent tricetin (CHEBI:507499) |
| tricetin(1-) (CHEBI:60045) is conjugate base of tricetin (CHEBI:507499) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 3',4',5,5',7-pentahydroxyflavone | ChEBI |
| 5,7,3',4',5'-Pentahydroxyflavone | KEGG COMPOUND |
| Tricetin | KEGG COMPOUND |
| Citations |
|---|