EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16O7 |
| Net Charge | 0 |
| Average Mass | 344.319 |
| Monoisotopic Mass | 344.08960 |
| SMILES | COc1cc(-c2cc(=O)c3c(O)cc(O)cc3o2)cc(OC)c1OC |
| InChI | InChI=1S/C18H16O7/c1-22-15-4-9(5-16(23-2)18(15)24-3)13-8-12(21)17-11(20)6-10(19)7-14(17)25-13/h4-8,19-20H,1-3H3 |
| InChIKey | CPCPHNWWTJLXKQ-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3',4',5'-O-trimethyltricetin (CHEBI:543745) has functional parent tricetin (CHEBI:507499) |
| 3',4',5'-O-trimethyltricetin (CHEBI:543745) is a 3',5'-dimethoxyflavone (CHEBI:138732) |
| 3',4',5'-O-trimethyltricetin (CHEBI:543745) is a dihydroxyflavone (CHEBI:38686) |
| 3',4',5'-O-trimethyltricetin (CHEBI:543745) is a trimethoxyflavone (CHEBI:27124) |
| 3',4',5'-O-trimethyltricetin (CHEBI:543745) is conjugate acid of 3',4',5'-O-trimethyltricetin(1−) (CHEBI:60020) |
| Incoming Relation(s) |
| 3',4',5'-O-trimethyltricetin(1−) (CHEBI:60020) is conjugate base of 3',4',5'-O-trimethyltricetin (CHEBI:543745) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-2-(3,4,5-trimethoxyphenyl)-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 5,7-dihydroxy-2-(3,4,5-trimethoxyphenyl)-4H-chromen-4-one | ChEMBL |
| 5,7-dihydroxy-3',4',5'-trimethoxyflavone | ChEMBL |
| 5,7-dihydroxy-2-(3,4,5-trimethoxyphenyl)-4H-1-benzopyran-4-one | ChemIDplus |
| 5,7-Dihydroxy-2-(3,4,5-trimethoxyphenyl)-4-benzopyrone | ChemIDplus |
| tricetin 3',4',5'-trimethyl ether | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:329782 | Reaxys |
| CAS:18103-42-9 | ChemIDplus |