EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H9O7 |
| Net Charge | -1 |
| Average Mass | 301.230 |
| Monoisotopic Mass | 301.03538 |
| SMILES | O=c1cc(-c2cc(O)c(O)c(O)c2)oc2cc([O-])cc(O)c12 |
| InChI | InChI=1S/C15H10O7/c16-7-3-8(17)14-9(18)5-12(22-13(14)4-7)6-1-10(19)15(21)11(20)2-6/h1-5,16-17,19-21H/p-1 |
| InChIKey | ARSRJFRKVXALTF-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tricetin(1-) (CHEBI:60045) is a flavonoid oxoanion (CHEBI:60038) |
| tricetin(1-) (CHEBI:60045) is conjugate base of tricetin (CHEBI:507499) |
| Incoming Relation(s) |
| tricetin (CHEBI:507499) is conjugate acid of tricetin(1-) (CHEBI:60045) |
| IUPAC Name |
|---|
| 5-hydroxy-4-oxo-2-(3,4,5-trihydroxyphenyl)-4H-chromen-7-olate |
| Synonyms | Source |
|---|---|
| tricetin 7-olate | ChEBI |
| tricetin anion | ChEBI |
| UniProt Name | Source |
|---|---|
| tricetin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-12570 | MetaCyc |