EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H12O7 |
| Net Charge | 0 |
| Average Mass | 316.265 |
| Monoisotopic Mass | 316.05830 |
| SMILES | COc1cc(-c2cc(=O)c3c(O)cc(O)cc3o2)cc(O)c1O |
| InChI | InChI=1S/C16H12O7/c1-22-14-3-7(2-11(20)16(14)21)12-6-10(19)15-9(18)4-8(17)5-13(15)23-12/h2-6,17-18,20-21H,1H3 |
| InChIKey | UGPOBASOHYMNAK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3'-O-methyltricetin (CHEBI:59976) has functional parent tricetin (CHEBI:507499) |
| 3'-O-methyltricetin (CHEBI:59976) has role antioxidant (CHEBI:22586) |
| 3'-O-methyltricetin (CHEBI:59976) has role metabolite (CHEBI:25212) |
| 3'-O-methyltricetin (CHEBI:59976) is a 3'-methoxyflavones (CHEBI:138730) |
| 3'-O-methyltricetin (CHEBI:59976) is a monomethoxyflavone (CHEBI:25401) |
| 3'-O-methyltricetin (CHEBI:59976) is a tetrahydroxyflavone (CHEBI:38684) |
| 3'-O-methyltricetin (CHEBI:59976) is conjugate acid of 3'-O-methyltricetin(1−) (CHEBI:60014) |
| Incoming Relation(s) |
| 3'-O-methyltricetin 3-O-α-L-rhamnopyranoside (CHEBI:75762) has functional parent 3'-O-methyltricetin (CHEBI:59976) |
| 3'-O-methyltricetin(1−) (CHEBI:60014) is conjugate base of 3'-O-methyltricetin (CHEBI:59976) |
| Synonyms | Source |
|---|---|
| selagin | ChEBI |
| selgin | ChEBI |
| tricetin 3'-O-methyl ether | ChEBI |
| tricetine 3'-O-methyl ether | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6574484 | Reaxys |
| Citations |
|---|