EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H15NO2S |
| Net Charge | 0 |
| Average Mass | 177.269 |
| Monoisotopic Mass | 177.08235 |
| SMILES | CSCCCCC(N)C(=O)O |
| InChI | InChI=1S/C7H15NO2S/c1-11-5-3-2-4-6(8)7(9)10/h6H,2-5,8H2,1H3,(H,9,10) |
| InChIKey | FBWIRBFZWNIGJC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dihomomethionine (CHEBI:50710) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| dihomomethionine (CHEBI:50710) is a sulfur-containing amino acid (CHEBI:26834) |
| dihomomethionine (CHEBI:50710) is tautomer of dihomomethionine zwitterion (CHEBI:58832) |
| Incoming Relation(s) |
| N-hydroxydihomomethionine (CHEBI:50758) has functional parent dihomomethionine (CHEBI:50710) |
| N,N-dihydroxydihomomethionine (CHEBI:50767) has functional parent dihomomethionine (CHEBI:50710) |
| L-dihomomethionine (CHEBI:136998) is a dihomomethionine (CHEBI:50710) |
| dihomomethionine zwitterion (CHEBI:58832) is tautomer of dihomomethionine (CHEBI:50710) |
| IUPAC Names |
|---|
| 2-amino-6-(methylsulfanyl)hexanoic acid |
| 6-(methylsulfanyl)norleucine |