EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H15NO4S |
| Net Charge | 0 |
| Average Mass | 209.267 |
| Monoisotopic Mass | 209.07218 |
| SMILES | CSCCCCC(C(=O)O)N(O)O |
| InChI | InChI=1S/C7H15NO4S/c1-13-5-3-2-4-6(7(9)10)8(11)12/h6,11-12H,2-5H2,1H3,(H,9,10) |
| InChIKey | QUWOJKUKIVDGKY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N,N-dihydroxydihomomethionine (CHEBI:50767) has functional parent dihomomethionine (CHEBI:50710) |
| N,N-dihydroxydihomomethionine (CHEBI:50767) is a N,N-dihydroxy-α-amino acid (CHEBI:50766) |
| N,N-dihydroxydihomomethionine (CHEBI:50767) is conjugate acid of N,N-dihydroxydihomomethioninate (CHEBI:58846) |
| Incoming Relation(s) |
| N,N-dihydroxy-L-dihomomethionine (CHEBI:137027) is a N,N-dihydroxydihomomethionine (CHEBI:50767) |
| N,N-dihydroxydihomomethioninate (CHEBI:58846) is conjugate base of N,N-dihydroxydihomomethionine (CHEBI:50767) |
| IUPAC Names |
|---|
| 2-(dihydroxyamino)-6-(methylsulfanyl)hexanoic acid |
| N,N-dihydroxy-6-(methylsulfanyl)norleucine |