EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H15NO3S |
| Net Charge | 0 |
| Average Mass | 193.268 |
| Monoisotopic Mass | 193.07726 |
| SMILES | CSCCCCC(NO)C(=O)O |
| InChI | InChI=1S/C7H15NO3S/c1-12-5-3-2-4-6(8-11)7(9)10/h6,8,11H,2-5H2,1H3,(H,9,10) |
| InChIKey | UCJWADAPVIQJLU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-hydroxydihomomethionine (CHEBI:50758) has functional parent dihomomethionine (CHEBI:50710) |
| N-hydroxydihomomethionine (CHEBI:50758) is a N-hydroxy-α-amino-acid (CHEBI:50760) |
| N-hydroxydihomomethionine (CHEBI:50758) is conjugate acid of N-hydroxydihomomethioninate (CHEBI:58840) |
| Incoming Relation(s) |
| N-hydroxy-L-dihomomethionine (CHEBI:137022) is a N-hydroxydihomomethionine (CHEBI:50758) |
| N-hydroxydihomomethioninate (CHEBI:58840) is conjugate base of N-hydroxydihomomethionine (CHEBI:50758) |
| IUPAC Names |
|---|
| 2-(hydroxyamino)-6-(methylsulfanyl)hexanoic acid |
| N-hydroxy-6-(methylsulfanyl)norleucine |