EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H15NO2S |
| Net Charge | 0 |
| Average Mass | 177.269 |
| Monoisotopic Mass | 177.08235 |
| SMILES | CSCCCCC([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C7H15NO2S/c1-11-5-3-2-4-6(8)7(9)10/h6H,2-5,8H2,1H3,(H,9,10) |
| InChIKey | FBWIRBFZWNIGJC-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dihomomethionine zwitterion (CHEBI:58832) is a amino-acid zwitterion (CHEBI:35238) |
| dihomomethionine zwitterion (CHEBI:58832) is tautomer of dihomomethionine (CHEBI:50710) |
| Incoming Relation(s) |
| L-dihomomethionine zwitterion (CHEBI:134632) is a dihomomethionine zwitterion (CHEBI:58832) |
| dihomomethionine (CHEBI:50710) is tautomer of dihomomethionine zwitterion (CHEBI:58832) |
| IUPAC Name |
|---|
| 2-azaniumyl-6-(methylsulfanyl)hexanoate |
| Synonym | Source |
|---|---|
| 2-ammonio-6-(methylsulfanyl)hexanoate | ChEBI |