EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H20O |
| Net Charge | 0 |
| Average Mass | 156.269 |
| Monoisotopic Mass | 156.15142 |
| SMILES | CC(C)=CCCC(C)CCO |
| InChI | InChI=1S/C10H20O/c1-9(2)5-4-6-10(3)7-8-11/h5,10-11H,4,6-8H2,1-3H3 |
| InChIKey | QMVPMAAFGQKVCJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Citrus hystrix (ncbitaxon:170989) | exocarp (BTO:0000733) | PubMed (20964319) | The hexane extract of dried and ground fruit peels |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| citronellol (CHEBI:50462) has role plant metabolite (CHEBI:76924) |
| citronellol (CHEBI:50462) is a monoterpenoid (CHEBI:25409) |
| Incoming Relation(s) |
| citronellol acetate (CHEBI:70478) has functional parent citronellol (CHEBI:50462) |
| (R)-(+)-citronellol (CHEBI:10360) is a citronellol (CHEBI:50462) |
| (S)-(−)-citronellol (CHEBI:88) is a citronellol (CHEBI:50462) |
| IUPAC Name |
|---|
| 3,7-dimethyloct-6-en-1-ol |
| Synonyms | Source |
|---|---|
| 2,3-Dihydrogeraniol | NIST Chemistry WebBook |
| 2,6-Dimethyl-2-octen-8-ol | ChemIDplus |
| 3,7-Dimethyl-6-octen-1-ol | ChemIDplus |
| Cephrol | NIST Chemistry WebBook |
| Elenol | NIST Chemistry WebBook |
| β-Citronellol | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| Citronellol | Wikipedia |
| Citations |
|---|