EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H20O |
| Net Charge | 0 |
| Average Mass | 156.269 |
| Monoisotopic Mass | 156.15142 |
| SMILES | CC(C)=CCC[C@H](C)CCO |
| InChI | InChI=1S/C10H20O/c1-9(2)5-4-6-10(3)7-8-11/h5,10-11H,4,6-8H2,1-3H3/t10-/m0/s1 |
| InChIKey | QMVPMAAFGQKVCJ-JTQLQIEISA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-(−)-citronellol (CHEBI:88) is a citronellol (CHEBI:50462) |
| (S)-(−)-citronellol (CHEBI:88) is enantiomer of (R)-(+)-citronellol (CHEBI:10360) |
| Incoming Relation(s) |
| (R)-(+)-citronellol (CHEBI:10360) is enantiomer of (S)-(−)-citronellol (CHEBI:88) |
| IUPAC Name |
|---|
| (3S)-3,7-dimethyloct-6-en-1-ol |
| Synonyms | Source |
|---|---|
| (-)-Citronellol | KEGG COMPOUND |
| (-)-3,7-Dimethyloct-6-en-1-ol | ChemIDplus |
| l-Citronellol | ChemIDplus |
| (S)-3,7-dimethyl-6-octen-1-ol | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| (S)-(−)-citronellol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C11386 | KEGG COMPOUND |
| LMPR0102010012 | LIPID MAPS |
| C00000844 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1721505 | Reaxys |
| CAS:7540-51-4 | KEGG COMPOUND |
| CAS:7540-51-4 | NIST Chemistry WebBook |