EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H20O |
| Net Charge | 0 |
| Average Mass | 156.269 |
| Monoisotopic Mass | 156.15142 |
| SMILES | CC(C)=CCC[C@@H](C)CCO |
| InChI | InChI=1S/C10H20O/c1-9(2)5-4-6-10(3)7-8-11/h5,10-11H,4,6-8H2,1-3H3/t10-/m1/s1 |
| InChIKey | QMVPMAAFGQKVCJ-SNVBAGLBSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-(+)-citronellol (CHEBI:10360) is a citronellol (CHEBI:50462) |
| (R)-(+)-citronellol (CHEBI:10360) is enantiomer of (S)-(−)-citronellol (CHEBI:88) |
| Incoming Relation(s) |
| (S)-(−)-citronellol (CHEBI:88) is enantiomer of (R)-(+)-citronellol (CHEBI:10360) |
| IUPAC Name |
|---|
| (3R)-3,7-dimethyloct-6-en-1-ol |
| Synonym | Source |
|---|---|
| (R)-(+)-Citronellol | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C09849 | KEGG COMPOUND |
| LMPR0102010008 | LIPID MAPS |
| C00003038 | KNApSAcK |
| C00000844 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1721506 | Reaxys |
| CAS:1117-61-9 | KEGG COMPOUND |
| CAS:1117-61-9 | ChemIDplus |