EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H22O2 |
| Net Charge | 0 |
| Average Mass | 198.306 |
| Monoisotopic Mass | 198.16198 |
| SMILES | CC(=O)OCCC(C)CCC=C(C)C |
| InChI | InChI=1S/C12H22O2/c1-10(2)6-5-7-11(3)8-9-14-12(4)13/h6,11H,5,7-9H2,1-4H3 |
| InChIKey | JOZKFWLRHCDGJA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Citrus hystrix (ncbitaxon:170989) | exocarp (BTO:0000733) | PubMed (20964319) | The hexane extract of dried and ground fruit peels |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| citronellol acetate (CHEBI:70478) has functional parent citronellol (CHEBI:50462) |
| citronellol acetate (CHEBI:70478) has role plant metabolite (CHEBI:76924) |
| citronellol acetate (CHEBI:70478) is a acetate ester (CHEBI:47622) |
| citronellol acetate (CHEBI:70478) is a monoterpenoid (CHEBI:25409) |
| IUPAC Name |
|---|
| 3,7-Dimethyl-6-octen-1-yl acetate |
| Synonyms | Source |
|---|---|
| β-citronellol acetate | HMDB |
| β-citronellyl acetate | HMDB |
| Manual Xrefs | Databases |
|---|---|
| C00035564 | KNApSAcK |
| C12298 | KEGG COMPOUND |
| HMDB0034160 | HMDB |
| LMPR0102010015 | LIPID MAPS |
| Citations |
|---|