EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H9NO3 |
| Net Charge | 0 |
| Average Mass | 167.164 |
| Monoisotopic Mass | 167.05824 |
| SMILES | NC(C(=O)O)c1ccc(O)cc1 |
| InChI | InChI=1S/C8H9NO3/c9-7(8(11)12)5-1-3-6(10)4-2-5/h1-4,7,10H,9H2,(H,11,12) |
| InChIKey | LJCWONGJFPCTTL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxyphenylglycine (CHEBI:50418) has functional parent glycine (CHEBI:15428) |
| 4-hydroxyphenylglycine (CHEBI:50418) has role bacterial metabolite (CHEBI:76969) |
| 4-hydroxyphenylglycine (CHEBI:50418) is a hydroxy-amino acid (CHEBI:24662) |
| Incoming Relation(s) |
| D-4-hydroxyphenylglycine (CHEBI:15695) is a 4-hydroxyphenylglycine (CHEBI:50418) |
| L-4-hydroxyphenylglycine (CHEBI:31755) is a 4-hydroxyphenylglycine (CHEBI:50418) |
| IUPAC Name |
|---|
| amino(4-hydroxyphenyl)acetic acid |
| Synonyms | Source |
|---|---|
| amino(4-hydroxyphenyl)ethanoic acid | ChEBI |
| PHPG | ChEBI |
| p-hydroxyphenylglycine | ChEBI |
| para-hydroxyphenylglycine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:513130 | Beilstein |