EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:31755 - L-4-hydroxyphenylglycine
| Formula | C8H9NO3 |
| Net Charge | 0 |
| Average Mass | 167.164 |
| Monoisotopic Mass | 167.05824 |
| SMILES | N[C@H](C(=O)O)c1ccc(O)cc1 |
| InChI | InChI=1S/C8H9NO3/c9-7(8(11)12)5-1-3-6(10)4-2-5/h1-4,7,10H,9H2,(H,11,12)/t7-/m0/s1 |
| InChIKey | LJCWONGJFPCTTL-ZETCQYMHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-4-hydroxyphenylglycine (CHEBI:31755) is a 4-hydroxyphenylglycine (CHEBI:50418) |
| L-4-hydroxyphenylglycine (CHEBI:31755) is enantiomer of D-4-hydroxyphenylglycine (CHEBI:15695) |
| L-4-hydroxyphenylglycine (CHEBI:31755) is tautomer of L-(4-hydroxymethyl)glycine zwitterion (CHEBI:234480) |
| Incoming Relation(s) |
| D-4-hydroxyphenylglycine (CHEBI:15695) is enantiomer of L-4-hydroxyphenylglycine (CHEBI:31755) |
| L-(4-hydroxymethyl)glycine zwitterion (CHEBI:234480) is tautomer of L-4-hydroxyphenylglycine (CHEBI:31755) |
| IUPAC Name |
|---|
| (2S)-amino(4-hydroxyphenyl)acetic acid |
| Synonym | Source |
|---|---|
| (2S)-amino(4-hydroxyphenyl)ethanoic acid | ChEBI |
| Citations |
|---|