EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H9NO3 |
| Net Charge | 0 |
| Average Mass | 167.164 |
| Monoisotopic Mass | 167.05824 |
| SMILES | N[C@@H](C(=O)O)c1ccc(O)cc1 |
| InChI | InChI=1S/C8H9NO3/c9-7(8(11)12)5-1-3-6(10)4-2-5/h1-4,7,10H,9H2,(H,11,12)/t7-/m1/s1 |
| InChIKey | LJCWONGJFPCTTL-SSDOTTSWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Herpetosiphon aurantiacus (ncbitaxon:65) | - | PubMed (22307823) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-4-hydroxyphenylglycine (CHEBI:15695) is a 4-hydroxyphenylglycine (CHEBI:50418) |
| D-4-hydroxyphenylglycine (CHEBI:15695) is enantiomer of L-4-hydroxyphenylglycine (CHEBI:31755) |
| D-4-hydroxyphenylglycine (CHEBI:15695) is tautomer of D-4-hydroxyphenylglycine zwitterion (CHEBI:57475) |
| Incoming Relation(s) |
| isonocardicin A (CHEBI:16483) has functional parent D-4-hydroxyphenylglycine (CHEBI:15695) |
| L-4-hydroxyphenylglycine (CHEBI:31755) is enantiomer of D-4-hydroxyphenylglycine (CHEBI:15695) |
| D-4-hydroxyphenylglycine zwitterion (CHEBI:57475) is tautomer of D-4-hydroxyphenylglycine (CHEBI:15695) |
| IUPAC Name |
|---|
| (2R)-amino(4-hydroxyphenyl)acetic acid |
| Synonyms | Source |
|---|---|
| D-4-Hydroxyphenylglycine | KEGG COMPOUND |
| (R)-alpha-Amino-4-hydroxybenzeneacetic acid | ChemIDplus |
| D-N-(4-Hydroxyphenyl)glycine | ChemIDplus |
| 4-HYDROXYPHENYLGLYCINE | PDBeChem |
| Manual Xrefs | Databases |
|---|---|
| C03493 | KEGG COMPOUND |
| GHP | PDBeChem |
| D-4-HYDROXYPHENYLGLYCINE | MetaCyc |
| US4260684 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6056393 | Reaxys |
| CAS:22818-40-2 | KEGG COMPOUND |
| CAS:22818-40-2 | ChemIDplus |
| Citations |
|---|