EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22NS |
| Net Charge | +1 |
| Average Mass | 296.459 |
| Monoisotopic Mass | 296.14675 |
| SMILES | C[NH+]1CCC(=C2c3ccccc3CCc3sccc32)CC1 |
| InChI | InChI=1S/C19H21NS/c1-20-11-8-15(9-12-20)19-16-5-3-2-4-14(16)6-7-18-17(19)10-13-21-18/h2-5,10,13H,6-9,11-12H2,1H3/p+1 |
| InChIKey | FIADGNVRKBPQEU-UHFFFAOYSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pizotifen(1+) (CHEBI:50318) is a ammonium ion derivative (CHEBI:35274) |
| pizotifen(1+) (CHEBI:50318) is a benzocycloheptathiophene (CHEBI:50219) |
| pizotifen(1+) (CHEBI:50318) is conjugate acid of pizotifen (CHEBI:50212) |
| Incoming Relation(s) |
| pizotifen malate (CHEBI:50213) has part pizotifen(1+) (CHEBI:50318) |
| pizotifen maleate (CHEBI:50214) has part pizotifen(1+) (CHEBI:50318) |
| pizotifen (CHEBI:50212) is conjugate base of pizotifen(1+) (CHEBI:50318) |