EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H21NS.C4H6O5 |
| Net Charge | 0 |
| Average Mass | 429.538 |
| Monoisotopic Mass | 429.16099 |
| SMILES | CN1CCC(=C2c3ccccc3CCc3sccc32)CC1.O=C(O)CC(O)C(=O)O |
| InChI | InChI=1S/C19H21NS.C4H6O5/c1-20-11-8-15(9-12-20)19-16-5-3-2-4-14(16)6-7-18-17(19)10-13-21-18;5-2(4(8)9)1-3(6)7/h2-5,10,13H,6-9,11-12H2,1H3;2,5H,1H2,(H,6,7)(H,8,9) |
| InChIKey | IWAWCPZVTXCFKD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| Applications: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pizotifen malate (CHEBI:50213) has part pizotifen(1+) (CHEBI:50318) |
| pizotifen malate (CHEBI:50213) has role histamine antagonist (CHEBI:37956) |
| pizotifen malate (CHEBI:50213) has role muscarinic antagonist (CHEBI:48876) |
| pizotifen malate (CHEBI:50213) has role serotonergic antagonist (CHEBI:48279) |
| pizotifen malate (CHEBI:50213) is a malate salt (CHEBI:50220) |
| IUPAC Name |
|---|
| 4-(9,10-dihydro-4H-benzo[4,5]cyclohepta[1,2-b]thiophen-4-ylidene)-1-methylpiperidine 2-hydroxybutanedioate |
| Synonyms | Source |
|---|---|
| Pizotifen hydrogen malate | ChemIDplus |
| Pizotyline malate | ChemIDplus |
| Brand Name | Source |
|---|---|
| Sandomigran | ChemIDplus |
| Citations |
|---|