EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H21NS.C4H4O4 |
| Net Charge | 0 |
| Average Mass | 411.523 |
| Monoisotopic Mass | 411.15043 |
| SMILES | CN1CCC(=C2c3ccccc3CCc3sccc32)CC1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C19H21NS.C4H4O4/c1-20-11-8-15(9-12-20)19-16-5-3-2-4-14(16)6-7-18-17(19)10-13-21-18;5-3(6)1-2-4(7)8/h2-5,10,13H,6-9,11-12H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | GGYSHFFKUHGBIK-BTJKTKAUSA-N |
| Roles Classification |
|---|
| Biological Roles: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. |
| Applications: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pizotifen maleate (CHEBI:50214) has part pizotifen(1+) (CHEBI:50318) |
| pizotifen maleate (CHEBI:50214) has role histamine antagonist (CHEBI:37956) |
| pizotifen maleate (CHEBI:50214) has role muscarinic antagonist (CHEBI:48876) |
| pizotifen maleate (CHEBI:50214) has role serotonergic antagonist (CHEBI:48279) |
| pizotifen maleate (CHEBI:50214) is a maleate salt (CHEBI:50221) |
| IUPAC Name |
|---|
| 4-(9,10-dihydro-4H-benzo[4,5]cyclohepta[1,2-b]thiophen-4-ylidene)-1-methylpiperidine (2Z)but-2-enedioate |
| Synonyms | Source |
|---|---|
| 4-(9,10-dihydro-4H-benzo[4,5]cyclohepta[1,2-b]thiophen-4-ylidene)-1-methylpiperidine maleate | ChEBI |
| 4-(9,10-dihydro-4H-benzo[4,5]cyclohepta[1,2-b]thiophen-4-ylidene)-1-methylpiperidinium (2Z)-3-carboxybut-2-enoate | IUPAC |
| 4-(9,10-dihydro-4H-benzo[4,5]cyclohepta[1,2-b]thiophen-4-ylidene)-1-methylpiperidinium hydrogen maleate | ChEBI |
| pizotifen hydrogen maleate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5720406 | Reaxys |
| CAS:24359-22-6 | ChemIDplus |
| Citations |
|---|