EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H21NS |
| Net Charge | 0 |
| Average Mass | 295.451 |
| Monoisotopic Mass | 295.13947 |
| SMILES | CN1CCC(=C2c3ccccc3CCc3sccc32)CC1 |
| InChI | InChI=1S/C19H21NS/c1-20-11-8-15(9-12-20)19-16-5-3-2-4-14(16)6-7-18-17(19)10-13-21-18/h2-5,10,13H,6-9,11-12H2,1H3 |
| InChIKey | FIADGNVRKBPQEU-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| Applications: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pizotifen (CHEBI:50212) has functional parent piperidine (CHEBI:18049) |
| pizotifen (CHEBI:50212) has role histamine antagonist (CHEBI:37956) |
| pizotifen (CHEBI:50212) has role muscarinic antagonist (CHEBI:48876) |
| pizotifen (CHEBI:50212) has role serotonergic antagonist (CHEBI:48279) |
| pizotifen (CHEBI:50212) is a benzocycloheptathiophene (CHEBI:50219) |
| pizotifen (CHEBI:50212) is conjugate base of pizotifen(1+) (CHEBI:50318) |
| Incoming Relation(s) |
| pizotifen(1+) (CHEBI:50318) is conjugate acid of pizotifen (CHEBI:50212) |
| IUPAC Name |
|---|
| 4-(9,10-dihydro-4H-benzo[4,5]cyclohepta[1,2-b]thiophen-4-ylidene)-1-methylpiperidine |
| INNs | Source |
|---|---|
| pizotifen | KEGG DRUG |
| pizotifene | ChemIDplus |
| pizotifeno | ChemIDplus |
| pizotifenum | ChemIDplus |
| Synonym | Source |
|---|---|
| Pizotyline | ChemIDplus |