EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H30O4 |
| Net Charge | 0 |
| Average Mass | 322.445 |
| Monoisotopic Mass | 322.21441 |
| SMILES | [H][C@]12CC[C@@H](C)C=C1C=C[C@H](C)[C@@H]2CC[C@@H](O)C[C@@H](O)CC(=O)O |
| InChI | InChI=1S/C19H30O4/c1-12-3-7-18-14(9-12)5-4-13(2)17(18)8-6-15(20)10-16(21)11-19(22)23/h4-5,9,12-13,15-18,20-21H,3,6-8,10-11H2,1-2H3,(H,22,23)/t12-,13+,15-,16-,17+,18+/m1/s1 |
| InChIKey | RPDSFBJYUHLDNI-MHMDBQTNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus terreus (ncbitaxon:33178) | - | PubMed (24534845) | Strain: ATCC 20542 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| monacolin L acid (CHEBI:82987) has functional parent monacolin L (CHEBI:50130) |
| monacolin L acid (CHEBI:82987) has role Aspergillus metabolite (CHEBI:76956) |
| monacolin L acid (CHEBI:82987) is a dihydroxy monocarboxylic acid (CHEBI:35972) |
| monacolin L acid (CHEBI:82987) is a hexahydronaphthalenes (CHEBI:142348) |
| monacolin L acid (CHEBI:82987) is a polyketide (CHEBI:26188) |
| monacolin L acid (CHEBI:82987) is conjugate acid of monacolin L carboxylate (CHEBI:79044) |
| Incoming Relation(s) |
| monacolin L carboxylate (CHEBI:79044) is conjugate base of monacolin L acid (CHEBI:82987) |
| IUPAC Name |
|---|
| (3R,5R)-7-[(1S,2S,6R,8aR)-2,6-dimethyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3,5-dihydroxyheptanoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8795513 | Reaxys |
| Citations |
|---|