EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H12N8O19P3 |
| Net Charge | -5 |
| Average Mass | 713.231 |
| Monoisotopic Mass | 712.94590 |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])[C@H]2OC3(O[C@H]21)C([N+](=O)[O-])=C[C-]([N+](=O)[O-])C=C3[N+](=O)[O-] |
| InChI | InChI=1S/C16H16N8O19P3/c17-13-10-14(19-4-18-13)21(5-20-10)15-12-11(7(39-15)3-38-45(34,35)43-46(36,37)42-44(31,32)33)40-16(41-12)8(23(27)28)1-6(22(25)26)2-9(16)24(29)30/h1-2,4-5,7,11-12,15H,3H2,(H,34,35)(H,36,37)(H2,17,18,19)(H2,31,32,33)/q-1/p-4/t7-,11-,12-,15-/m1/s1 |
| InChIKey | SRBOSGVHTINDAV-UHEGPQQHSA-J |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| TNP-ATP5− (CHEBI:50105) has functional parent ATP(4−) (CHEBI:30616) |
| TNP-ATP5− (CHEBI:50105) is a organophosphate oxoanion (CHEBI:58945) |
| TNP-ATP5− (CHEBI:50105) is conjugate base of TNP-ATP (CHEBI:50104) |
| Incoming Relation(s) |
| TNP-ATP (CHEBI:50104) is conjugate acid of TNP-ATP5− (CHEBI:50105) |
| IUPAC Name |
|---|
| 2',3'-O-(2,4,6-trinitrocyclohexadienide-1,1-diyl)adenosine 5'-triphosphate |
| Registry Numbers | Sources |
|---|---|
| CAS:61368-63-6 | ChemIDplus |