EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | [H]C1=C([H])C(C)(C)CC=C(C)CCC=C(C)C1 |
| InChI | InChI=1S/C15H24/c1-13-7-5-8-14(2)10-12-15(3,4)11-6-9-13/h6-7,10-11H,5,8-9,12H2,1-4H3 |
| InChIKey | FAMPSKZZVDUYOS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-humulene (CHEBI:49311) has role plant metabolite (CHEBI:76924) |
| α-humulene (CHEBI:49311) has role volatile oil component (CHEBI:27311) |
| α-humulene (CHEBI:49311) is a humulene (CHEBI:49289) |
| Incoming Relation(s) |
| zerumbone (CHEBI:63892) has parent hydride α-humulene (CHEBI:49311) |
| zerumboneoxide (CHEBI:66502) has parent hydride α-humulene (CHEBI:49311) |
| (1E,4E,8E)-α-humulene (CHEBI:5768) is a α-humulene (CHEBI:49311) |
| IUPAC Names |
|---|
| 2,6,6,9-tetramethylcycloundeca-1,4,8-triene |
| humula-1(11),4,8-triene |
| Synonym | Source |
|---|---|
| α-Humulen | ChEBI |