EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22O |
| Net Charge | 0 |
| Average Mass | 218.340 |
| Monoisotopic Mass | 218.16707 |
| SMILES | C/C1=C\CC(C)(C)/C=C/C(=O)/C(C)=C/CC1 |
| InChI | InChI=1S/C15H22O/c1-12-6-5-7-13(2)14(16)9-11-15(3,4)10-8-12/h7-9,11H,5-6,10H2,1-4H3/b11-9+,12-8+,13-7+ |
| InChIKey | GIHNTRQPEMKFKO-SKTNYSRSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Zingiber aromaticum (IPNI:798315-1) | rhizome (BTO:0001181) | DOI (10.1080/10575639708043725) | |
| Zingiber zerumbet (ncbitaxon:311405) | rhizome (BTO:0001181) | PubMed (15997145) | |
| Zingiber cassumunar (IPNI:798323-1) | rhizome (BTO:0001181) | PubMed (1804548) |
| Roles Classification |
|---|
| Biological Roles: | glioma-associated oncogene inhibitor An inhibitor of any of the glioma-associated oncogene (GLI) proteins. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zerumbone (CHEBI:63892) has parent hydride α-humulene (CHEBI:49311) |
| zerumbone (CHEBI:63892) has role anti-inflammatory agent (CHEBI:67079) |
| zerumbone (CHEBI:63892) has role glioma-associated oncogene inhibitor (CHEBI:140922) |
| zerumbone (CHEBI:63892) has role plant metabolite (CHEBI:76924) |
| zerumbone (CHEBI:63892) is a cyclic ketone (CHEBI:3992) |
| zerumbone (CHEBI:63892) is a sesquiterpenoid (CHEBI:26658) |
| Incoming Relation(s) |
| 5-hydroxyzerumbone (CHEBI:66050) has functional parent zerumbone (CHEBI:63892) |
| zerumboneoxide (CHEBI:66502) has functional parent zerumbone (CHEBI:63892) |
| IUPAC Name |
|---|
| (2E,6E,10E)-2,6,9,9-tetramethylcycloundeca-2,6,10-trien-1-one |
| Synonyms | Source |
|---|---|
| (E,E,E)-2,6,9,9-tetramethyl-2,6,10-cycloundecatrien-1-one | ChemIDplus |
| 2E,6E,9E-humulatrien-8-one | ChEBI |
| UniProt Name | Source |
|---|---|
| zerumbone | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-11421 | MetaCyc |
| US2009239953 | Patent |
| C20262 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3199411 | Reaxys |
| CAS:471-05-6 | ChemIDplus |
| Citations |
|---|