EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22O2 |
| Net Charge | 0 |
| Average Mass | 234.339 |
| Monoisotopic Mass | 234.16198 |
| SMILES | [H][C@]12CC(C)(C)/C=C/C(=O)/C(C)=C/CC[C@@]1(C)O2 |
| InChI | InChI=1S/C15H22O2/c1-11-6-5-8-15(4)13(17-15)10-14(2,3)9-7-12(11)16/h6-7,9,13H,5,8,10H2,1-4H3/b9-7+,11-6+/t13-,15+/m0/s1 |
| InChIKey | UXYYOHOTPOQJPD-QNKGIFIZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Zingiber zerumbet (ncbitaxon:311405) | rhizome (BTO:0001181) | PubMed (15997145) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 1.14.13.39 (nitric oxide synthase) inhibitor An EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor that interferes with the action of nitric oxide synthase (EC 1.14.13.39). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zerumboneoxide (CHEBI:66502) has functional parent zerumbone (CHEBI:63892) |
| zerumboneoxide (CHEBI:66502) has parent hydride α-humulene (CHEBI:49311) |
| zerumboneoxide (CHEBI:66502) has role EC 1.14.13.39 (nitric oxide synthase) inhibitor (CHEBI:61908) |
| zerumboneoxide (CHEBI:66502) has role metabolite (CHEBI:25212) |
| zerumboneoxide (CHEBI:66502) is a cyclic ketone (CHEBI:3992) |
| zerumboneoxide (CHEBI:66502) is a enone (CHEBI:51689) |
| zerumboneoxide (CHEBI:66502) is a epoxide (CHEBI:32955) |
| zerumboneoxide (CHEBI:66502) is a sesquiterpenoid (CHEBI:26658) |
| IUPAC Name |
|---|
| (1R,4E,7E,11S)-1,5,9,9-tetramethyl-12-oxabicyclo[9.1.0]dodeca-4,7-dien-6-one |
| Synonyms | Source |
|---|---|
| (2R,3R)-epoxy-6E,9E-humulatrien-8-one | ChEBI |
| zerumbone epoxide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1620548 | Reaxys |
| Citations |
|---|