EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | C/C1=C\CC/C(C)=C/CC(C)(C)/C=C/C1 |
| InChI | InChI=1S/C15H24/c1-13-7-5-8-14(2)10-12-15(3,4)11-6-9-13/h6-7,10-11H,5,8-9,12H2,1-4H3/b11-6+,13-7+,14-10+ |
| InChIKey | FAMPSKZZVDUYOS-HRGUGZIWSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1E,4E,8E)-α-humulene (CHEBI:5768) is a α-humulene (CHEBI:49311) |
| IUPAC Names |
|---|
| (1E,4E,8E)-2,6,6,9-tetramethylcycloundeca-1,4,8-triene |
| (1E,4E,8E)-humula-1(11),4,8-triene |
| Synonyms | Source |
|---|---|
| (1E,4E,8E)-2,6,6,9-tetramethyl-1,4,8-cycloundecatriene | ChemIDplus |
| Humulene | KEGG COMPOUND |
| (E,E,E)-2,6,6,9-tetramethyl-1,4,8-cycloundecatriene | NIST Chemistry WebBook |
| α-caryophyllene | NIST Chemistry WebBook |
| α-humulene | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| α-humulene | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00003147 | KNApSAcK |
| C09684 | KEGG COMPOUND |
| HMDB0036467 | HMDB |
| Humulene | Wikipedia |
| LMPR0103110001 | LIPID MAPS |
| Citations |
|---|