EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O2 |
| Net Charge | 0 |
| Average Mass | 114.144 |
| Monoisotopic Mass | 114.06808 |
| SMILES | [H]C(=CCC(=O)O)CC |
| InChI | InChI=1S/C6H10O2/c1-2-3-4-5-6(7)8/h3-4H,2,5H2,1H3,(H,7,8) |
| InChIKey | XXHDAWYDNSXJQM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hexenoic acid (CHEBI:49283) has role plant metabolite (CHEBI:76924) |
| 3-hexenoic acid (CHEBI:49283) is a hexenoic acid (CHEBI:24580) |
| Incoming Relation(s) |
| 6-hydroxyhex-3-enoic acid (CHEBI:49293) has functional parent 3-hexenoic acid (CHEBI:49283) |
| ethyl 3-hexenoate (CHEBI:87560) has functional parent 3-hexenoic acid (CHEBI:49283) |
| cis-hex-3-enoic acid (CHEBI:49284) is a 3-hexenoic acid (CHEBI:49283) |
| trans-hex-3-enoic acid (CHEBI:49285) is a 3-hexenoic acid (CHEBI:49283) |
| IUPAC Name |
|---|
| hex-3-enoic acid |
| Synonyms | Source |
|---|---|
| 3-Hexenoic acid | ChemIDplus |
| 3-hexenoic acids | ChEBI |
| Hex-3-en-carbonsäure | ChEBI |
| hex-3-enoic acids | ChEBI |
| Hex-3-ensäure | ChEBI |
| Hydrosorbic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| CN101200421 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1745294 | Reaxys |
| CAS:4219-24-3 | ChemIDplus |
| Citations |
|---|