EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O2 |
| Net Charge | 0 |
| Average Mass | 114.144 |
| Monoisotopic Mass | 114.06808 |
| SMILES | CC/C=C\CC(=O)O |
| InChI | InChI=1S/C6H10O2/c1-2-3-4-5-6(7)8/h3-4H,2,5H2,1H3,(H,7,8)/b4-3- |
| InChIKey | XXHDAWYDNSXJQM-ARJAWSKDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Psidium guajava (ncbitaxon:120290) | - | PubMed (4013523) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cis-hex-3-enoic acid (CHEBI:49284) is a 3-hexenoic acid (CHEBI:49283) |
| Incoming Relation(s) |
| (Z)-hex-3-enoyl-CoA (CHEBI:85889) has functional parent cis-hex-3-enoic acid (CHEBI:49284) |
| IUPAC Name |
|---|
| (3Z)-hex-3-enoic acid |
| Synonyms | Source |
|---|---|
| (3Z)-3-Hexenoic acid | ChemIDplus |
| 6:1, n-3 cis | ChEBI |
| C6:1, n-3 cis | ChEBI |
| cis-3-Hexenoic acid | ChemIDplus |
| hex-3c-enoic acid | ChEBI |
| cis-Hex-3-ensäure | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1902955 | Reaxys |
| CAS:1775-43-5 | ChemIDplus |
| Citations |
|---|