EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H14O2 |
| Net Charge | 0 |
| Average Mass | 142.198 |
| Monoisotopic Mass | 142.09938 |
| SMILES | [H]C(=CCC(=O)OCC)CC |
| InChI | InChI=1S/C8H14O2/c1-3-5-6-7-8(9)10-4-2/h5-6H,3-4,7H2,1-2H3 |
| InChIKey | VTSFIPHRNAESED-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethyl 3-hexenoate (CHEBI:87560) has functional parent 3-hexenoic acid (CHEBI:49283) |
| ethyl 3-hexenoate (CHEBI:87560) has role metabolite (CHEBI:25212) |
| ethyl 3-hexenoate (CHEBI:87560) is a fatty acid ethyl ester (CHEBI:78206) |
| IUPAC Name |
|---|
| ethyl hex-3-enoate |
| Citations |
|---|