EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O3 |
| Net Charge | 0 |
| Average Mass | 130.143 |
| Monoisotopic Mass | 130.06299 |
| SMILES | [H]C(=CCC(=O)O)CCO |
| InChI | InChI=1S/C6H10O3/c7-5-3-1-2-4-6(8)9/h1-2,7H,3-5H2,(H,8,9) |
| InChIKey | WCTFRVNMBORSRQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-hydroxyhex-3-enoic acid (CHEBI:49293) has functional parent 3-hexenoic acid (CHEBI:49283) |
| 6-hydroxyhex-3-enoic acid (CHEBI:49293) is a homoallylic alcohol (CHEBI:134362) |
| 6-hydroxyhex-3-enoic acid (CHEBI:49293) is a hydroxy monounsaturated fatty acid (CHEBI:131869) |
| 6-hydroxyhex-3-enoic acid (CHEBI:49293) is a medium-chain fatty acid (CHEBI:59554) |
| 6-hydroxyhex-3-enoic acid (CHEBI:49293) is a straight-chain fatty acid (CHEBI:59202) |
| Incoming Relation(s) |
| 6-hydroxyhex-3-enoyl-CoA (CHEBI:49281) has functional parent 6-hydroxyhex-3-enoic acid (CHEBI:49293) |
| IUPAC Name |
|---|
| 6-hydroxyhex-3-enoic acid |
| Synonym | Source |
|---|---|
| 6-hydroxy-3-hexenoic acid | ChEBI |