EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H26O8 |
| Net Charge | 0 |
| Average Mass | 418.442 |
| Monoisotopic Mass | 418.16277 |
| SMILES | COc1cc(C2OCC3C(c4cc(OC)c(O)c(OC)c4)OCC23)cc(OC)c1O |
| InChI | InChI=1S/C22H26O8/c1-25-15-5-11(6-16(26-2)19(15)23)21-13-9-30-22(14(13)10-29-21)12-7-17(27-3)20(24)18(8-12)28-4/h5-8,13-14,21-24H,9-10H2,1-4H3 |
| InChIKey | KOWMJRJXZMEZLD-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Epimedium koreanum (ncbitaxon:63351) | - | PubMed (12081149) | |
| Avicennia germinans (ncbitaxon:41378) | - | PubMed (11152952) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| syringaresinol (CHEBI:49211) has role plant metabolite (CHEBI:76924) |
| syringaresinol (CHEBI:49211) is a aromatic ether (CHEBI:35618) |
| syringaresinol (CHEBI:49211) is a furofuran (CHEBI:47790) |
| syringaresinol (CHEBI:49211) is a lignan (CHEBI:25036) |
| syringaresinol (CHEBI:49211) is a polyether (CHEBI:46774) |
| syringaresinol (CHEBI:49211) is a polyphenol (CHEBI:26195) |
| Incoming Relation(s) |
| buddlenol C (CHEBI:86635) has functional parent syringaresinol (CHEBI:49211) |
| (+)-syringaresinol (CHEBI:47) is a syringaresinol (CHEBI:49211) |
| (−)-syringaresinol (CHEBI:49212) is a syringaresinol (CHEBI:49211) |
| syringylresinol diacetate (CHEBI:86951) is a syringaresinol (CHEBI:49211) |
| IUPAC Name |
|---|
| 3,3',5,5'-tetramethoxy-7,9':7',9-diepoxylignane-4,4'-diol |
| Synonyms | Source |
|---|---|
| 4,4'-tetrahydro-1H,3H-furo[3,4-c]furan-1,4-diylbis(2,6-dimethoxyphenol) | IUPAC |
| S(8-8)S | ChEBI |
| 4,4'-tetrahydro-1h,3h-furo[3,4-c]furan-1,4-diylbis(2,6-dimethoxyphenol) | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| 100067 | PubChem Compound |
| Citations |
|---|