EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H30O10 |
| Net Charge | 0 |
| Average Mass | 502.516 |
| Monoisotopic Mass | 502.18390 |
| SMILES | COc1cc(C2OCC3C(c4cc(OC)c(OC(C)=O)c(OC)c4)OCC23)cc(OC)c1OC(C)=O |
| InChI | InChI=1S/C26H30O10/c1-13(27)35-25-19(29-3)7-15(8-20(25)30-4)23-17-11-34-24(18(17)12-33-23)16-9-21(31-5)26(36-14(2)28)22(10-16)32-6/h7-10,17-18,23-24H,11-12H2,1-6H3 |
| InChIKey | FEDJEJQAGQWOHV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| syringylresinol diacetate (CHEBI:86951) is a acetate ester (CHEBI:47622) |
| syringylresinol diacetate (CHEBI:86951) is a dimethoxybenzene (CHEBI:51681) |
| syringylresinol diacetate (CHEBI:86951) is a lignan (CHEBI:25036) |
| syringylresinol diacetate (CHEBI:86951) is a syringaresinol (CHEBI:49211) |
| IUPAC Name |
|---|
| (tetrahydro-1H,3H-furo[3,4-c]furan-1,4-diyl)bis(2,6-dimethoxy-4,1-phenylene) diacetate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:376010 | Reaxys |