EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H26O8 |
| Net Charge | 0 |
| Average Mass | 418.442 |
| Monoisotopic Mass | 418.16277 |
| SMILES | [H][C@]12CO[C@H](c3cc(OC)c(O)c(OC)c3)[C@@]1([H])CO[C@@H]2c1cc(OC)c(O)c(OC)c1 |
| InChI | InChI=1S/C22H26O8/c1-25-15-5-11(6-16(26-2)19(15)23)21-13-9-30-22(14(13)10-29-21)12-7-17(27-3)20(24)18(8-12)28-4/h5-8,13-14,21-24H,9-10H2,1-4H3/t13-,14-,21+,22+/m0/s1 |
| InChIKey | KOWMJRJXZMEZLD-HCIHMXRSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arcangelisia gusanlung (ncbitaxon:432629) | stem (BTO:0001300) | PubMed (21500777) | MeOH extract of air-dried and smashed stems |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-syringaresinol (CHEBI:47) has role antineoplastic agent (CHEBI:35610) |
| (+)-syringaresinol (CHEBI:47) is a syringaresinol (CHEBI:49211) |
| (+)-syringaresinol (CHEBI:47) is enantiomer of (−)-syringaresinol (CHEBI:49212) |
| Incoming Relation(s) |
| (+)-syringaresinol β-D-glucoside (CHEBI:28603) has functional parent (+)-syringaresinol (CHEBI:47) |
| (−)-syringaresinol (CHEBI:49212) is enantiomer of (+)-syringaresinol (CHEBI:47) |
| IUPAC Name |
|---|
| (7α,7'α,8α,8'α)-3,3',5,5'-tetramethoxy-7,9':7',9-diepoxylignane-4,4'-diol |
| Synonyms | Source |
|---|---|
| 4,4'-(1S,3aR,4S,6aR)-tetrahydro-1H,3H-furo[3,4-c]furan-1,4-diylbis(2,6-dimethoxyphenol) | IUPAC |
| (+)-Syringaresinol | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4585066 | Reaxys |
| CAS:21453-69-0 | KEGG COMPOUND |
| CAS:21453-69-0 | ChemIDplus |
| Citations |
|---|