EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H38O12 |
| Net Charge | 0 |
| Average Mass | 614.644 |
| Monoisotopic Mass | 614.23633 |
| SMILES | COc1cc(C(O)C(CO)Oc2c(OC)cc(C3OCC4C(c5cc(OC)c(O)c(OC)c5)OCC34)cc2OC)ccc1O |
| InChI | InChI=1S/C32H38O12/c1-37-22-8-16(6-7-21(22)34)28(35)27(13-33)44-32-25(40-4)11-18(12-26(32)41-5)31-20-15-42-30(19(20)14-43-31)17-9-23(38-2)29(36)24(10-17)39-3/h6-12,19-20,27-28,30-31,33-36H,13-15H2,1-5H3 |
| InChIKey | FITCDKVKQIBVRK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | |||
| root (BTO:0001188) | PubMed (25457500) | ||
| root (BTO:0001188) | MetaboLights (MTBLS160) | ||
| Illicium simonsii (ncbitaxon:1202800) | |||
| leaf (BTO:0000713) | PubMed (21837972) | ||
| stem (BTO:0001300) | PubMed (21837972) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| buddlenol C (CHEBI:86635) has functional parent guaiacylglycerol (CHEBI:53663) |
| buddlenol C (CHEBI:86635) has functional parent syringaresinol (CHEBI:49211) |
| buddlenol C (CHEBI:86635) has role plant metabolite (CHEBI:76924) |
| buddlenol C (CHEBI:86635) is a dimethoxybenzene (CHEBI:51681) |
| buddlenol C (CHEBI:86635) is a furofuran (CHEBI:47790) |
| buddlenol C (CHEBI:86635) is a guaiacyl lignin (CHEBI:64475) |
| buddlenol C (CHEBI:86635) is a polyphenol (CHEBI:26195) |
| buddlenol C (CHEBI:86635) is a primary alcohol (CHEBI:15734) |
| buddlenol C (CHEBI:86635) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| 2-{4-[4-(4-hydroxy-3,5-dimethoxyphenyl)tetrahydro-1H,3H-furo[3,4-c]furan-1-yl]-2,6-dimethoxyphenoxy}-1-(4-hydroxy-3-methoxyphenyl)propane-1,3-diol |
| Synonyms | Source |
|---|---|
| G(8-O-4)S(8-8)S | ChEBI |
| guaiacylglycerol β-syringaresinol ether | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00038659 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6554468 | Reaxys |
| CAS:97465-73-1 | KNApSAcK |
| Citations |
|---|