EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13NO4 |
| Net Charge | 0 |
| Average Mass | 211.217 |
| Monoisotopic Mass | 211.08446 |
| SMILES | CN[C@H](Cc1ccc(O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C10H13NO4/c1-11-7(10(14)15)4-6-2-3-8(12)9(13)5-6/h2-3,5,7,11-13H,4H2,1H3,(H,14,15)/t7-/m1/s1 |
| InChIKey | QZIWDCLHLOADPK-SSDOTTSWSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-methyl-D-dopa (CHEBI:167647) has functional parent D-dopa (CHEBI:49169) |
| N-methyl-D-dopa (CHEBI:167647) is a N-methyldopa (CHEBI:167648) |
| N-methyl-D-dopa (CHEBI:167647) is enantiomer of N-methyl-L-dopa (CHEBI:167646) |
| N-methyl-D-dopa (CHEBI:167647) is tautomer of N-methyl-D-dopa zwitterion (CHEBI:167491) |
| Incoming Relation(s) |
| N-methyl-L-dopa (CHEBI:167646) is enantiomer of N-methyl-D-dopa (CHEBI:167647) |
| N-methyl-D-dopa zwitterion (CHEBI:167491) is tautomer of N-methyl-D-dopa (CHEBI:167647) |
| IUPAC Name |
|---|
| 3-hydroxy-N-methyl-D-tyrosine |
| Synonyms | Source |
|---|---|
| (2R)-3-(3,4-dihydroxyphenyl)-2-(methylamino)propanoic acid | IUPAC |
| N-methyl-3,4-dihydroxy-D-phenylalanine | ChEBI |
| β-(3,4-dihydroxyphenyl)-N-methyl-D-alanine | ChEBI |