EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11NO5 |
| Net Charge | 0 |
| Average Mass | 213.189 |
| Monoisotopic Mass | 213.06372 |
| SMILES | NC(Cc1cc(O)c(O)cc1O)C(=O)O |
| InChI | InChI=1S/C9H11NO5/c10-5(9(14)15)1-4-2-7(12)8(13)3-6(4)11/h2-3,5,11-13H,1,10H2,(H,14,15) |
| InChIKey | YLKRUSPZOTYMAT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-hydroxydopa (CHEBI:20725) has functional parent dopa (CHEBI:49168) |
| 6-hydroxydopa (CHEBI:20725) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| IUPAC Name |
|---|
| 2-amino-3-(2,4,5-trihydroxyphenyl)propanoic acid |
| Synonyms | Source |
|---|---|
| 2,4,5-trihydroxyphenylalanine | ChemIDplus |
| 2,5-dihydroxytyrosine | ChemIDplus |
| 3,4,6-topa | ChemIDplus |
| 3,4,6-trihydroxyphenylalanine | ChemIDplus |
| 6-OHdopa | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:21373-30-8 | ChemIDplus |