EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H16O7 |
| Net Charge | 0 |
| Average Mass | 332.308 |
| Monoisotopic Mass | 332.08960 |
| SMILES | COC(=O)c1cc(O)cc(OC)c1C(=O)c1c(O)cc(C)cc1O |
| InChI | InChI=1S/C17H16O7/c1-8-4-11(19)15(12(20)5-8)16(21)14-10(17(22)24-3)6-9(18)7-13(14)23-2/h4-7,18-20H,1-3H3 |
| InChIKey | YJRLSCDUYLRBIZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulochrin (CHEBI:16159) has functional parent demethylsulochrin (CHEBI:48948) |
| sulochrin (CHEBI:16159) has role metabolite (CHEBI:25212) |
| sulochrin (CHEBI:16159) is a benzophenones (CHEBI:22726) |
| sulochrin (CHEBI:16159) is a carboxylic ester (CHEBI:33308) |
| sulochrin (CHEBI:16159) is a phenols (CHEBI:33853) |
| sulochrin (CHEBI:16159) is conjugate acid of sulochrin(1−) (CHEBI:77639) |
| Incoming Relation(s) |
| dihydrogeodin (CHEBI:155891) has functional parent sulochrin (CHEBI:16159) |
| sulochrin(1−) (CHEBI:77639) is conjugate base of sulochrin (CHEBI:16159) |
| IUPAC Name |
|---|
| methyl 2-(2,6-dihydroxy-4-methylbenzoyl)-5-hydroxy-3-methoxybenzoate |
| Synonym | Source |
|---|---|
| Sulochrin | KEGG COMPOUND |
| Citations |
|---|