EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H13O7 |
| Net Charge | -1 |
| Average Mass | 317.273 |
| Monoisotopic Mass | 317.06668 |
| SMILES | COc1cc(O)cc(C(=O)[O-])c1C(=O)c1c(O)cc(C)cc1O |
| InChI | InChI=1S/C16H14O7/c1-7-3-10(18)14(11(19)4-7)15(20)13-9(16(21)22)5-8(17)6-12(13)23-2/h3-6,17-19H,1-2H3,(H,21,22)/p-1 |
| InChIKey | XMNMFMYKFRXRFH-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| demethylsulochrin(1−) (CHEBI:58760) is a hydroxy monocarboxylic acid anion (CHEBI:36059) |
| demethylsulochrin(1−) (CHEBI:58760) is conjugate acid of demethylsulochrin(2−) (CHEBI:77886) |
| demethylsulochrin(1−) (CHEBI:58760) is conjugate base of demethylsulochrin (CHEBI:48948) |
| Incoming Relation(s) |
| demethylsulochrin (CHEBI:48948) is conjugate acid of demethylsulochrin(1−) (CHEBI:58760) |
| demethylsulochrin(2−) (CHEBI:77886) is conjugate base of demethylsulochrin(1−) (CHEBI:58760) |
| IUPAC Name |
|---|
| 2-(2,6-dihydroxy-4-methylbenzoyl)-5-hydroxy-3-methoxybenzoate |