EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H10Cl2NO2 |
| Net Charge | -1 |
| Average Mass | 295.145 |
| Monoisotopic Mass | 294.00941 |
| SMILES | O=C([O-])Cc1ccccc1Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C14H11Cl2NO2/c15-10-5-3-6-11(16)14(10)17-12-7-2-1-4-9(12)8-13(18)19/h1-7,17H,8H2,(H,18,19)/p-1 |
| InChIKey | DCOPUUMXTXDBNB-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diclofenac(1−) (CHEBI:48311) is a monocarboxylic acid anion (CHEBI:35757) |
| diclofenac(1−) (CHEBI:48311) is conjugate base of diclofenac (CHEBI:47381) |
| Incoming Relation(s) |
| diclofenac epolamine (CHEBI:48296) has part diclofenac(1−) (CHEBI:48311) |
| diclofenac potassium (CHEBI:4508) has part diclofenac(1−) (CHEBI:48311) |
| diclofenac sodium (CHEBI:4509) has part diclofenac(1−) (CHEBI:48311) |
| diclofenac (CHEBI:47381) is conjugate acid of diclofenac(1−) (CHEBI:48311) |
| IUPAC Name |
|---|
| {2-[(2,6-dichlorophenyl)amino]phenyl}acetate |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3560933 | Beilstein |